About (5R,11S)-spiro[5.5]undecane-5,11-diol
(5R,11S)-spiro[5.5]undecane-5,11-diol (PubChem CID 10997722) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (5R,11S)-spiro[5.5]undecane-5,11-diol.
Molecular Properties
| Compound Name | (5R,11S)-spiro[5.5]undecane-5,11-diol |
| PubChem CID | 10997722 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (5R,11S)-spiro[5.5]undecane-5,11-diol |
| SMILES | O[C@@H]1CCCCC12CCCC[C@@H]2O |
| InChI | InChI=1S/C11H20O2/c12-9-5-1-3-7-11(9)8-4-2-6-10(11)13/h9-10,12-13H,1-8H2/t9-,10+,11? |
| InChIKey | ZESWSZILXOPASX-ZACCUICWSA-N |
| XLogP | 1.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R,11S)-spiro[5.5]undecane-5,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,11S)-spiro[5.5]undecane-5,11-diol?
The IUPAC name of (5R,11S)-spiro[5.5]undecane-5,11-diol (CID 10997722) is (5R,11S)-spiro[5.5]undecane-5,11-diol.
What is the SMILES notation for (5R,11S)-spiro[5.5]undecane-5,11-diol?
The canonical SMILES for (5R,11S)-spiro[5.5]undecane-5,11-diol is O[C@@H]1CCCCC12CCCC[C@@H]2O.
What is the InChIKey of (5R,11S)-spiro[5.5]undecane-5,11-diol?
The InChIKey is ZESWSZILXOPASX-ZACCUICWSA-N. The full InChI is InChI=1S/C11H20O2/c12-9-5-1-3-7-11(9)8-4-2-6-10(11)13/h9-10,12-13H,1-8H2/t9-,10+,11?.
What are the key properties of (5R,11S)-spiro[5.5]undecane-5,11-diol?
(5R,11S)-spiro[5.5]undecane-5,11-diol has a molecular weight of 184.28 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,11S)-spiro[5.5]undecane-5,11-diol is sourced from PubChem (CID 10997722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).