C11H20O3 — CID 10998033
(E,1S)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]but-2-en-1-ol (PubChem CID 10998033) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (E,1S)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]but-2-en-1-ol.
| Compound Name | (E,1S)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 10998033 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (E,1S)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]but-2-en-1-ol |
| SMILES | C/C=C/[C@H](O)[C@H]1COC(CC)(CC)O1 |
| InChI | InChI=1S/C11H20O3/c1-4-7-9(12)10-8-13-11(5-2,6-3)14-10/h4,7,9-10,12H,5-6,8H2,1-3H3/b7-4+/t9-,10+/m0/s1 |
| InChIKey | JFLTXADQKXJTTO-JDWDQXLLSA-N |
| XLogP | 1.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|