C10H16OS2 — CID 10998449
1-(1,3-dithian-2-yl)cyclohex-2-en-1-ol (PubChem CID 10998449) has the molecular formula C10H16OS2 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)cyclohex-2-en-1-ol.
| Compound Name | 1-(1,3-dithian-2-yl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10998449 |
| Molecular Formula | C10H16OS2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-(1,3-dithian-2-yl)cyclohex-2-en-1-ol |
| SMILES | OC1(C2SCCCS2)C=CCCC1 |
| InChI | InChI=1S/C10H16OS2/c11-10(5-2-1-3-6-10)9-12-7-4-8-13-9/h2,5,9,11H,1,3-4,6-8H2 |
| InChIKey | BXAYQNWOCOYACP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|