C13H14FNO — CID 10998517
(2E)-N-ethyl-2-(6-fluoro-2,3-dihydroinden-1-ylidene)acetamide (PubChem CID 10998517) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is (2E)-N-ethyl-2-(6-fluoro-2,3-dihydroinden-1-ylidene)acetamide.
| Compound Name | (2E)-N-ethyl-2-(6-fluoro-2,3-dihydroinden-1-ylidene)acetamide |
|---|---|
| PubChem CID | 10998517 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (2E)-N-ethyl-2-(6-fluoro-2,3-dihydroinden-1-ylidene)acetamide |
| SMILES | CCNC(=O)/C=C1\CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FNO/c1-2-15-13(16)7-10-4-3-9-5-6-11(14)8-12(9)10/h5-8H,2-4H2,1H3,(H,15,16)/b10-7+ |
| InChIKey | GMLITQNTHVEDGC-JXMROGBWSA-N |
| XLogP | 2.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|