C15H24O — CID 10998571
(2R,5R,9S,10R)-2-ethenyl-2,6,9,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene (PubChem CID 10998571) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (2R,5R,9S,10R)-2-ethenyl-2,6,9,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene.
| Compound Name | (2R,5R,9S,10R)-2-ethenyl-2,6,9,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 10998571 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2R,5R,9S,10R)-2-ethenyl-2,6,9,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene |
| SMILES | C=C[C@@]1(C)CC[C@]2(O1)C(C)=CC[C@H](C)[C@H]2C |
| InChI | InChI=1S/C15H24O/c1-6-14(5)9-10-15(16-14)12(3)8-7-11(2)13(15)4/h6,8,11,13H,1,7,9-10H2,2-5H3/t11-,13+,14-,15-/m0/s1 |
| InChIKey | CVZXLAAMZXBCMM-ATGSNQNLSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|