About hexyl N-cyclohexylcarbamate
hexyl N-cyclohexylcarbamate (PubChem CID 10998746) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is hexyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | hexyl N-cyclohexylcarbamate |
| PubChem CID | 10998746 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | hexyl N-cyclohexylcarbamate |
| SMILES | CCCCCCOC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H25NO2/c1-2-3-4-8-11-16-13(15)14-12-9-6-5-7-10-12/h12H,2-11H2,1H3,(H,14,15) |
| InChIKey | PXKAHSXZPDMGBF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl N-cyclohexylcarbamate?
The IUPAC name of hexyl N-cyclohexylcarbamate (CID 10998746) is hexyl N-cyclohexylcarbamate.
What is the SMILES notation for hexyl N-cyclohexylcarbamate?
The canonical SMILES for hexyl N-cyclohexylcarbamate is CCCCCCOC(=O)NC1CCCCC1.
What is the InChIKey of hexyl N-cyclohexylcarbamate?
The InChIKey is PXKAHSXZPDMGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-2-3-4-8-11-16-13(15)14-12-9-6-5-7-10-12/h12H,2-11H2,1H3,(H,14,15).
What are the key properties of hexyl N-cyclohexylcarbamate?
hexyl N-cyclohexylcarbamate has a molecular weight of 227.35 g/mol, XLogP of 3.63, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl N-cyclohexylcarbamate is sourced from PubChem (CID 10998746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).