About 2-hydroxypropyl 4-methylbenzenesulfonate
2-hydroxypropyl 4-methylbenzenesulfonate (PubChem CID 10998810) has the molecular formula C10H14O4S
and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-hydroxypropyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 4-methylbenzenesulfonate |
| PubChem CID | 10998810 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-hydroxypropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)O)cc1 |
| InChI | InChI=1S/C10H14O4S/c1-8-3-5-10(6-4-8)15(12,13)14-7-9(2)11/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | ZRLDVMGSMOLUOJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 4-methylbenzenesulfonate?
The IUPAC name of 2-hydroxypropyl 4-methylbenzenesulfonate (CID 10998810) is 2-hydroxypropyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-hydroxypropyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-hydroxypropyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(C)O)cc1.
What is the InChIKey of 2-hydroxypropyl 4-methylbenzenesulfonate?
The InChIKey is ZRLDVMGSMOLUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4S/c1-8-3-5-10(6-4-8)15(12,13)14-7-9(2)11/h3-6,9,11H,7H2,1-2H3.
What are the key properties of 2-hydroxypropyl 4-methylbenzenesulfonate?
2-hydroxypropyl 4-methylbenzenesulfonate has a molecular weight of 230.28 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 4-methylbenzenesulfonate is sourced from PubChem (CID 10998810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).