About (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol
(2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol (PubChem CID 10998847) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol |
| PubChem CID | 10998847 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@@H](O)C[C@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C14H17NO2/c1-2-6-13(16)9-12-10-17-14(15-12)11-7-4-3-5-8-11/h2-5,7-8,12-13,16H,1,6,9-10H2/t12-,13+/m0/s1 |
| InChIKey | ANCUFHVEGSXAPZ-QWHCGFSZSA-N |
| XLogP | 2.16 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol?
The IUPAC name of (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol (CID 10998847) is (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol.
What is the SMILES notation for (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol?
The canonical SMILES for (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol is C=CC[C@@H](O)C[C@H]1COC(c2ccccc2)=N1.
What is the InChIKey of (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol?
The InChIKey is ANCUFHVEGSXAPZ-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H17NO2/c1-2-6-13(16)9-12-10-17-14(15-12)11-7-4-3-5-8-11/h2-5,7-8,12-13,16H,1,6,9-10H2/t12-,13+/m0/s1.
What are the key properties of (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol?
(2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol has a molecular weight of 231.30 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]pent-4-en-2-ol is sourced from PubChem (CID 10998847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).