C16H29N — CID 10998976
(5R,8R,8aS)-5-[(Z)-hept-4-enyl]-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 10998976) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (5R,8R,8aS)-5-[(Z)-hept-4-enyl]-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (5R,8R,8aS)-5-[(Z)-hept-4-enyl]-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 10998976 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (5R,8R,8aS)-5-[(Z)-hept-4-enyl]-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CC/C=C\CCC[C@@H]1CC[C@@H](C)[C@@H]2CCCN12 |
| InChI | InChI=1S/C16H29N/c1-3-4-5-6-7-9-15-12-11-14(2)16-10-8-13-17(15)16/h4-5,14-16H,3,6-13H2,1-2H3/b5-4-/t14-,15-,16+/m1/s1 |
| InChIKey | XWQTZZRSURTNFY-BKBHSOPASA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|