About (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene
(2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene (PubChem CID 10999187) has the molecular formula C16H15FO
and a molecular weight of 242.29 g/mol. Its IUPAC name is (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene.
Molecular Properties
| Compound Name | (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene |
| PubChem CID | 10999187 |
| Molecular Formula | C16H15FO |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene |
| SMILES | CO[C@]1(c2ccccc2)c2ccccc2C[C@H]1F |
| InChI | InChI=1S/C16H15FO/c1-18-16(13-8-3-2-4-9-13)14-10-6-5-7-12(14)11-15(16)17/h2-10,15H,11H2,1H3/t15-,16-/m1/s1 |
| InChIKey | COOIVDSZJWYRKB-HZPDHXFCSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene?
The IUPAC name of (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene (CID 10999187) is (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene.
What is the SMILES notation for (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene?
The canonical SMILES for (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene is CO[C@]1(c2ccccc2)c2ccccc2C[C@H]1F.
What is the InChIKey of (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene?
The InChIKey is COOIVDSZJWYRKB-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H15FO/c1-18-16(13-8-3-2-4-9-13)14-10-6-5-7-12(14)11-15(16)17/h2-10,15H,11H2,1H3/t15-,16-/m1/s1.
What are the key properties of (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene?
(2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene has a molecular weight of 242.29 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-fluoro-3-methoxy-3-phenyl-1,2-dihydroindene is sourced from PubChem (CID 10999187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).