C13H22O4 — CID 10999192
2-[(3aR,5S,7aS)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxol-5-yl]propane-1,3-diol (PubChem CID 10999192) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-[(3aR,5S,7aS)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxol-5-yl]propane-1,3-diol.
| Compound Name | 2-[(3aR,5S,7aS)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxol-5-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 10999192 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[(3aR,5S,7aS)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxol-5-yl]propane-1,3-diol |
| SMILES | CC1(C)O[C@@H]2C[C@H](C(CO)CO)C=C[C@]2(C)O1 |
| InChI | InChI=1S/C13H22O4/c1-12(2)16-11-6-9(10(7-14)8-15)4-5-13(11,3)17-12/h4-5,9-11,14-15H,6-8H2,1-3H3/t9-,11-,13+/m1/s1 |
| InChIKey | SKVRKEFZOPSANJ-XWIASGKRSA-N |
| XLogP | 1.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|