About 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene
1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene (PubChem CID 10999471) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene |
| PubChem CID | 10999471 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene |
| SMILES | c1ccc2c(c1)CCC2OC1CCc2ccccc21 |
| InChI | InChI=1S/C18H18O/c1-3-7-15-13(5-1)9-11-17(15)19-18-12-10-14-6-2-4-8-16(14)18/h1-8,17-18H,9-12H2 |
| InChIKey | YQRRFIKLPFQWAO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene?
The IUPAC name of 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene (CID 10999471) is 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene.
What is the SMILES notation for 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene?
The canonical SMILES for 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene is c1ccc2c(c1)CCC2OC1CCc2ccccc21.
What is the InChIKey of 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene?
The InChIKey is YQRRFIKLPFQWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O/c1-3-7-15-13(5-1)9-11-17(15)19-18-12-10-14-6-2-4-8-16(14)18/h1-8,17-18H,9-12H2.
What are the key properties of 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene?
1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene has a molecular weight of 250.34 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-inden-1-yloxy)-2,3-dihydro-1H-indene is sourced from PubChem (CID 10999471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).