C15H30N2O — CID 10999622
(E,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylheptan-1-imine (PubChem CID 10999622) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (E,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylheptan-1-imine.
| Compound Name | (E,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylheptan-1-imine |
|---|---|
| PubChem CID | 10999622 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (E,2S,4S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4-dimethylheptan-1-imine |
| SMILES | CCC[C@H](C)C[C@H](C)/C=N/N1CCC[C@H]1COC |
| InChI | InChI=1S/C15H30N2O/c1-5-7-13(2)10-14(3)11-16-17-9-6-8-15(17)12-18-4/h11,13-15H,5-10,12H2,1-4H3/b16-11+/t13-,14-,15-/m0/s1 |
| InChIKey | IEDOAQZLQNIVOU-LLSPYPMZSA-N |
| XLogP | 3.55 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|