C15H19NO3 — CID 10999832
(2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methyl-3,6-dihydro-2H-pyran-2-carboxamide (PubChem CID 10999832) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methyl-3,6-dihydro-2H-pyran-2-carboxamide.
| Compound Name | (2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methyl-3,6-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 10999832 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methyl-3,6-dihydro-2H-pyran-2-carboxamide |
| SMILES | CC1=CCO[C@@H](C(=O)N[C@H](CO)c2ccccc2)C1 |
| InChI | InChI=1S/C15H19NO3/c1-11-7-8-19-14(9-11)15(18)16-13(10-17)12-5-3-2-4-6-12/h2-7,13-14,17H,8-10H2,1H3,(H,16,18)/t13-,14-/m1/s1 |
| InChIKey | XICXLHWUEPDYAB-ZIAGYGMSSA-N |
| XLogP | 1.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|