C17H15NO2 — CID 10999952
(4S,5R)-3-ethenyl-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 10999952) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4S,5R)-3-ethenyl-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-ethenyl-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10999952 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (4S,5R)-3-ethenyl-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C=CN1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c1-2-18-15(13-9-5-3-6-10-13)16(20-17(18)19)14-11-7-4-8-12-14/h2-12,15-16H,1H2/t15-,16+/m0/s1 |
| InChIKey | YMWLLIXQZQMQKV-JKSUJKDBSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |