C16H26O3 — CID 10999998
(2S)-2-[(1S)-1-hydroxyheptyl]-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 10999998) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-hydroxyheptyl]-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | (2S)-2-[(1S)-1-hydroxyheptyl]-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 10999998 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (2S)-2-[(1S)-1-hydroxyheptyl]-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCCCC[C@H](O)[C@@H]1CCC2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C16H26O3/c1-2-3-4-5-7-14(18)16-11-10-12-13(17)8-6-9-15(12)19-16/h14,16,18H,2-11H2,1H3/t14-,16-/m0/s1 |
| InChIKey | JOBYEAFXXMAMPL-HOCLYGCPSA-N |
| XLogP | 3.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|