C15H24N2O3 — CID 110000216
N-(2-hydroxypentyl)-6-[(2-methylpropan-2-yl)oxy]pyridine-3-carboxamide (PubChem CID 110000216) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(2-hydroxypentyl)-6-[(2-methylpropan-2-yl)oxy]pyridine-3-carboxamide.
| Compound Name | N-(2-hydroxypentyl)-6-[(2-methylpropan-2-yl)oxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110000216 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-(2-hydroxypentyl)-6-[(2-methylpropan-2-yl)oxy]pyridine-3-carboxamide |
| SMILES | CCCC(O)CNC(=O)c1ccc(OC(C)(C)C)nc1 |
| InChI | InChI=1S/C15H24N2O3/c1-5-6-12(18)10-17-14(19)11-7-8-13(16-9-11)20-15(2,3)4/h7-9,12,18H,5-6,10H2,1-4H3,(H,17,19) |
| InChIKey | CORJOKIECXJJPE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |