C16H21N5O2 — CID 110000274
N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-(4-hydroxypiperidin-1-yl)benzamide (PubChem CID 110000274) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-(4-hydroxypiperidin-1-yl)benzamide.
| Compound Name | N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-(4-hydroxypiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 110000274 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-(4-hydroxypiperidin-1-yl)benzamide |
| SMILES | CCc1nc(NC(=O)c2ccc(N3CCC(O)CC3)cc2)n[nH]1 |
| InChI | InChI=1S/C16H21N5O2/c1-2-14-17-16(20-19-14)18-15(23)11-3-5-12(6-4-11)21-9-7-13(22)8-10-21/h3-6,13,22H,2,7-10H2,1H3,(H2,17,18,19,20,23) |
| InChIKey | HCVIDJQSMRXXJJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |