About 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide (PubChem CID 110000666) has the molecular formula C16H21FN2O3
and a molecular weight of 308.35 g/mol. Its IUPAC name is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide |
| PubChem CID | 110000666 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide |
| SMILES | CC(C)(CO)NC(=O)CCN1C(=O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C16H21FN2O3/c1-16(2,10-20)18-14(21)7-8-19-13-5-4-12(17)9-11(13)3-6-15(19)22/h4-5,9,20H,3,6-8,10H2,1-2H3,(H,18,21) |
| InChIKey | FGBFZSFRHMSDBN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide?
The IUPAC name of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide (CID 110000666) is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide.
What is the SMILES notation for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide?
The canonical SMILES for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide is CC(C)(CO)NC(=O)CCN1C(=O)CCc2cc(F)ccc21.
What is the InChIKey of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide?
The InChIKey is FGBFZSFRHMSDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21FN2O3/c1-16(2,10-20)18-14(21)7-8-19-13-5-4-12(17)9-11(13)3-6-15(19)22/h4-5,9,20H,3,6-8,10H2,1-2H3,(H,18,21).
What are the key properties of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide?
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide has a molecular weight of 308.35 g/mol, XLogP of 1.38, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-2-methylpropan-2-yl)propanamide is sourced from PubChem (CID 110000666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).