About [(E)-1,2-diphenylethenoxy]-trimethylsilane
[(E)-1,2-diphenylethenoxy]-trimethylsilane (PubChem CID 11000074) has the molecular formula C17H20OSi
and a molecular weight of 268.43 g/mol. Its IUPAC name is [(E)-1,2-diphenylethenoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-1,2-diphenylethenoxy]-trimethylsilane |
| PubChem CID | 11000074 |
| Molecular Formula | C17H20OSi |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [(E)-1,2-diphenylethenoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)O/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20OSi/c1-19(2,3)18-17(16-12-8-5-9-13-16)14-15-10-6-4-7-11-15/h4-14H,1-3H3/b17-14+ |
| InChIKey | PYQMBKPWEPUANG-SAPNQHFASA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1,2-diphenylethenoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,2-diphenylethenoxy]-trimethylsilane?
The IUPAC name of [(E)-1,2-diphenylethenoxy]-trimethylsilane (CID 11000074) is [(E)-1,2-diphenylethenoxy]-trimethylsilane.
What is the SMILES notation for [(E)-1,2-diphenylethenoxy]-trimethylsilane?
The canonical SMILES for [(E)-1,2-diphenylethenoxy]-trimethylsilane is C[Si](C)(C)O/C(=C/c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-1,2-diphenylethenoxy]-trimethylsilane?
The InChIKey is PYQMBKPWEPUANG-SAPNQHFASA-N. The full InChI is InChI=1S/C17H20OSi/c1-19(2,3)18-17(16-12-8-5-9-13-16)14-15-10-6-4-7-11-15/h4-14H,1-3H3/b17-14+.
What are the key properties of [(E)-1,2-diphenylethenoxy]-trimethylsilane?
[(E)-1,2-diphenylethenoxy]-trimethylsilane has a molecular weight of 268.43 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,2-diphenylethenoxy]-trimethylsilane is sourced from PubChem (CID 11000074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).