About 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide (PubChem CID 110002185) has the molecular formula C18H25FN2O3
and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide.
Molecular Properties
| Compound Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide |
| PubChem CID | 110002185 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide |
| SMILES | CCC(C)(CCO)NC(=O)CCN1C(=O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C18H25FN2O3/c1-3-18(2,9-11-22)20-16(23)8-10-21-15-6-5-14(19)12-13(15)4-7-17(21)24/h5-6,12,22H,3-4,7-11H2,1-2H3,(H,20,23) |
| InChIKey | FQQSUJBNTUUPEQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide?
The IUPAC name of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide (CID 110002185) is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide.
What is the SMILES notation for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide?
The canonical SMILES for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide is CCC(C)(CCO)NC(=O)CCN1C(=O)CCc2cc(F)ccc21.
What is the InChIKey of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide?
The InChIKey is FQQSUJBNTUUPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25FN2O3/c1-3-18(2,9-11-22)20-16(23)8-10-21-15-6-5-14(19)12-13(15)4-7-17(21)24/h5-6,12,22H,3-4,7-11H2,1-2H3,(H,20,23).
What are the key properties of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide?
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide has a molecular weight of 336.41 g/mol, XLogP of 2.16, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-(1-hydroxy-3-methylpentan-3-yl)propanamide is sourced from PubChem (CID 110002185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).