C14H18F3NO — CID 11000221
1,1,1-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]pent-4-en-2-amine (PubChem CID 11000221) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]pent-4-en-2-amine.
| Compound Name | 1,1,1-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 11000221 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1,1,1-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]pent-4-en-2-amine |
| SMILES | C=CCC(N[C@@H](COC)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO/c1-3-7-13(14(15,16)17)18-12(10-19-2)11-8-5-4-6-9-11/h3-6,8-9,12-13,18H,1,7,10H2,2H3/t12-,13?/m0/s1 |
| InChIKey | XZPFXUKETSLRLI-UEWDXFNNSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|