C18H21ClN2O3 — CID 110002777
5-(4-chlorophenyl)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)pyridine-3-carboxamide (PubChem CID 110002777) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)pyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110002777 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)pyridine-3-carboxamide |
| SMILES | COCC(C)(CCO)NC(=O)c1cncc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-18(7-8-22,12-24-2)21-17(23)15-9-14(10-20-11-15)13-3-5-16(19)6-4-13/h3-6,9-11,22H,7-8,12H2,1-2H3,(H,21,23) |
| InChIKey | SWLPVWXFNYCVFN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |