C17H25NO3 — CID 110002888
(E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-4-(4-methylphenyl)but-3-enamide (PubChem CID 110002888) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-4-(4-methylphenyl)but-3-enamide.
| Compound Name | (E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-4-(4-methylphenyl)but-3-enamide |
|---|---|
| PubChem CID | 110002888 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-4-(4-methylphenyl)but-3-enamide |
| SMILES | COCC(C)(CCO)NC(=O)C/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-14-7-9-15(10-8-14)5-4-6-16(20)18-17(2,11-12-19)13-21-3/h4-5,7-10,19H,6,11-13H2,1-3H3,(H,18,20)/b5-4+ |
| InChIKey | ZNANXEGZQDHWQW-SNAWJCMRSA-N |
| XLogP | 2.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |