C15H19NO4 — CID 11000346
(3R,4S)-3-buta-1,3-dien-2-yl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-1-prop-2-ynylazetidin-2-one (PubChem CID 11000346) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3R,4S)-3-buta-1,3-dien-2-yl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-1-prop-2-ynylazetidin-2-one.
| Compound Name | (3R,4S)-3-buta-1,3-dien-2-yl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-1-prop-2-ynylazetidin-2-one |
|---|---|
| PubChem CID | 11000346 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (3R,4S)-3-buta-1,3-dien-2-yl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-1-prop-2-ynylazetidin-2-one |
| SMILES | C#CCN1C(=O)[C@@](O)(C(=C)C=C)[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H19NO4/c1-6-8-16-12(11-9-19-14(4,5)20-11)15(18,13(16)17)10(3)7-2/h1,7,11-12,18H,2-3,8-9H2,4-5H3/t11-,12+,15-/m1/s1 |
| InChIKey | FMORQPUGNDYBLR-TYNCELHUSA-N |
| XLogP | 0.46 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|