C16H25N3O3 — CID 110003942
(E)-N-[(2-hydroxycyclohexyl)methyl]-N-methyl-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide (PubChem CID 110003942) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (E)-N-[(2-hydroxycyclohexyl)methyl]-N-methyl-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2-hydroxycyclohexyl)methyl]-N-methyl-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 110003942 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (E)-N-[(2-hydroxycyclohexyl)methyl]-N-methyl-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide |
| SMILES | CC(C)c1nnc(/C=C/C(=O)N(C)CC2CCCCC2O)o1 |
| InChI | InChI=1S/C16H25N3O3/c1-11(2)16-18-17-14(22-16)8-9-15(21)19(3)10-12-6-4-5-7-13(12)20/h8-9,11-13,20H,4-7,10H2,1-3H3/b9-8+ |
| InChIKey | DMCGLKNUVWKSBS-CMDGGOBGSA-N |
| XLogP | 2.22 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|