C17H30OSi — CID 11000407
tert-butyl-dimethyl-[(3E,7E)-9-methyldeca-1,3,7,9-tetraen-2-yl]oxysilane (PubChem CID 11000407) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E,7E)-9-methyldeca-1,3,7,9-tetraen-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3E,7E)-9-methyldeca-1,3,7,9-tetraen-2-yl]oxysilane |
|---|---|
| PubChem CID | 11000407 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | tert-butyl-dimethyl-[(3E,7E)-9-methyldeca-1,3,7,9-tetraen-2-yl]oxysilane |
| SMILES | C=C(C)/C=C/CC/C=C/C(=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30OSi/c1-15(2)13-11-9-10-12-14-16(3)18-19(7,8)17(4,5)6/h11-14H,1,3,9-10H2,2,4-8H3/b13-11+,14-12+ |
| InChIKey | HRTNUNILXZSDHN-PHEQNACWSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|