C14H23N3O2S — CID 110004143
N-(1-hydroxy-4,4-dimethylpentan-2-yl)-2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide (PubChem CID 110004143) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-2-yl)-2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-2-yl)-2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110004143 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-2-yl)-2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNc1ncc(C(=O)NC(CO)CC(C)(C)C)s1 |
| InChI | InChI=1S/C14H23N3O2S/c1-5-6-15-13-16-8-11(20-13)12(19)17-10(9-18)7-14(2,3)4/h5,8,10,18H,1,6-7,9H2,2-4H3,(H,15,16)(H,17,19) |
| InChIKey | SJQHASOGQFEQKU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|