C15H15Cl2NO2S — CID 110004644
N-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(5-chlorothiophen-2-yl)propanamide (PubChem CID 110004644) has the molecular formula C15H15Cl2NO2S and a molecular weight of 344.26 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(5-chlorothiophen-2-yl)propanamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(5-chlorothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 110004644 |
| Molecular Formula | C15H15Cl2NO2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(5-chlorothiophen-2-yl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)s1)NC(CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2NO2S/c16-11-3-1-10(2-4-11)13(9-19)18-15(20)8-6-12-5-7-14(17)21-12/h1-5,7,13,19H,6,8-9H2,(H,18,20) |
| InChIKey | YAGBXHMCKKBSFU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |