About [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride
[4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride (PubChem CID 110004677) has the molecular formula C13H21ClN2O2S
and a molecular weight of 304.84 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride |
| PubChem CID | 110004677 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride |
| SMILES | COCC(C)/N=C(\N)SCc1ccc(CO)cc1.Cl |
| InChI | InChI=1S/C13H20N2O2S.ClH/c1-10(8-17-2)15-13(14)18-9-12-5-3-11(7-16)4-6-12;/h3-6,10,16H,7-9H2,1-2H3,(H2,14,15);1H |
| InChIKey | OTKHFSZMJYZROF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride?
The IUPAC name of [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride (CID 110004677) is [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride.
What is the SMILES notation for [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride?
The canonical SMILES for [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride is COCC(C)/N=C(\N)SCc1ccc(CO)cc1.Cl.
What is the InChIKey of [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride?
The InChIKey is OTKHFSZMJYZROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S.ClH/c1-10(8-17-2)15-13(14)18-9-12-5-3-11(7-16)4-6-12;/h3-6,10,16H,7-9H2,1-2H3,(H2,14,15);1H.
What are the key properties of [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride?
[4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride has a molecular weight of 304.84 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)phenyl]methyl N'-(1-methoxypropan-2-yl)carbamimidothioate;hydrochloride is sourced from PubChem (CID 110004677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).