About [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol
[4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol (PubChem CID 110005770) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol |
| PubChem CID | 110005770 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol |
| SMILES | O=S(=O)(Cc1ccc(CO)cc1)Cc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H17N3O3S/c21-10-14-6-8-15(9-7-14)11-24(22,23)12-17-18-13-20(19-17)16-4-2-1-3-5-16/h1-9,13,21H,10-12H2 |
| InChIKey | KMDPHDFEYOHQSC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol?
The IUPAC name of [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol (CID 110005770) is [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol.
What is the SMILES notation for [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol?
The canonical SMILES for [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol is O=S(=O)(Cc1ccc(CO)cc1)Cc1ncn(-c2ccccc2)n1.
What is the InChIKey of [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol?
The InChIKey is KMDPHDFEYOHQSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3S/c21-10-14-6-8-15(9-7-14)11-24(22,23)12-17-18-13-20(19-17)16-4-2-1-3-5-16/h1-9,13,21H,10-12H2.
What are the key properties of [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol?
[4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol has a molecular weight of 343.41 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfonylmethyl]phenyl]methanol is sourced from PubChem (CID 110005770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).