C18H22O3 — CID 11000652
2-(1-hydroxypropylidene)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 11000652) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-(1-hydroxypropylidene)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-(1-hydroxypropylidene)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11000652 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-(1-hydroxypropylidene)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | CCC(O)=C1C(=O)CC(c2c(C)cc(C)cc2C)CC1=O |
| InChI | InChI=1S/C18H22O3/c1-5-14(19)18-15(20)8-13(9-16(18)21)17-11(3)6-10(2)7-12(17)4/h6-7,13,19H,5,8-9H2,1-4H3/b18-14- |
| InChIKey | VWMWNVLYXWBXMU-JXAWBTAJSA-N |
| XLogP | 3.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|