About [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol
[4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol (PubChem CID 110006833) has the molecular formula C16H15NO2S2
and a molecular weight of 317.44 g/mol. Its IUPAC name is [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol |
| PubChem CID | 110006833 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol |
| SMILES | OCc1ccc(CSCc2csc(-c3ccoc3)n2)cc1 |
| InChI | InChI=1S/C16H15NO2S2/c18-7-12-1-3-13(4-2-12)9-20-10-15-11-21-16(17-15)14-5-6-19-8-14/h1-6,8,11,18H,7,9-10H2 |
| InChIKey | TTXAQHSJQPJPEV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol?
The IUPAC name of [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol (CID 110006833) is [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol.
What is the SMILES notation for [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol?
The canonical SMILES for [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol is OCc1ccc(CSCc2csc(-c3ccoc3)n2)cc1.
What is the InChIKey of [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol?
The InChIKey is TTXAQHSJQPJPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2S2/c18-7-12-1-3-13(4-2-12)9-20-10-15-11-21-16(17-15)14-5-6-19-8-14/h1-6,8,11,18H,7,9-10H2.
What are the key properties of [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol?
[4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol has a molecular weight of 317.44 g/mol, XLogP of 4.33, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanylmethyl]phenyl]methanol is sourced from PubChem (CID 110006833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).