C13H20O3S2 — CID 110007047
[4-[(2-methyl-3-methylsulfonylpropyl)sulfanylmethyl]phenyl]methanol (PubChem CID 110007047) has the molecular formula C13H20O3S2 and a molecular weight of 288.43 g/mol. Its IUPAC name is [4-[(2-methyl-3-methylsulfonylpropyl)sulfanylmethyl]phenyl]methanol.
| Compound Name | [4-[(2-methyl-3-methylsulfonylpropyl)sulfanylmethyl]phenyl]methanol |
|---|---|
| PubChem CID | 110007047 |
| Molecular Formula | C13H20O3S2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [4-[(2-methyl-3-methylsulfonylpropyl)sulfanylmethyl]phenyl]methanol |
| SMILES | CC(CSCc1ccc(CO)cc1)CS(C)(=O)=O |
| InChI | InChI=1S/C13H20O3S2/c1-11(10-18(2,15)16)8-17-9-13-5-3-12(7-14)4-6-13/h3-6,11,14H,7-10H2,1-2H3 |
| InChIKey | NZTJJNOJLKCLAC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |