C10H21FN2O2 — CID 110007196
1-(3-fluoropropyl)-3-(1-hydroxy-4-methylpentan-2-yl)urea (PubChem CID 110007196) has the molecular formula C10H21FN2O2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-3-(1-hydroxy-4-methylpentan-2-yl)urea.
| Compound Name | 1-(3-fluoropropyl)-3-(1-hydroxy-4-methylpentan-2-yl)urea |
|---|---|
| PubChem CID | 110007196 |
| Molecular Formula | C10H21FN2O2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(3-fluoropropyl)-3-(1-hydroxy-4-methylpentan-2-yl)urea |
| SMILES | CC(C)CC(CO)NC(=O)NCCCF |
| InChI | InChI=1S/C10H21FN2O2/c1-8(2)6-9(7-14)13-10(15)12-5-3-4-11/h8-9,14H,3-7H2,1-2H3,(H2,12,13,15) |
| InChIKey | FBWLDWDWLHXDDQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|