C17H17FN2O3S — CID 110007391
(E)-N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)but-2-enediamide (PubChem CID 110007391) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is (E)-N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)but-2-enediamide.
| Compound Name | (E)-N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)but-2-enediamide |
|---|---|
| PubChem CID | 110007391 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (E)-N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)but-2-enediamide |
| SMILES | CC(O)(CNC(=O)/C=C/C(=O)Nc1ccc(F)cc1)c1ccsc1 |
| InChI | InChI=1S/C17H17FN2O3S/c1-17(23,12-8-9-24-10-12)11-19-15(21)6-7-16(22)20-14-4-2-13(18)3-5-14/h2-10,23H,11H2,1H3,(H,19,21)(H,20,22)/b7-6+ |
| InChIKey | KEVQFMUICJMPJQ-VOTSOKGWSA-N |
| XLogP | 2.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|