About (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate
(8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 11000871) has the molecular formula C11H9F3O4S
and a molecular weight of 294.25 g/mol. Its IUPAC name is (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate |
| PubChem CID | 11000871 |
| Molecular Formula | C11H9F3O4S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1CCCc2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H9F3O4S/c12-11(13,14)19(16,17)18-8-5-4-7-2-1-3-10(15)9(7)6-8/h4-6H,1-3H2 |
| InChIKey | BNPHNMWQBDBABL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate?
The IUPAC name of (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate (CID 11000871) is (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate.
What is the SMILES notation for (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate?
The canonical SMILES for (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate is O=C1CCCc2ccc(OS(=O)(=O)C(F)(F)F)cc21.
What is the InChIKey of (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate?
The InChIKey is BNPHNMWQBDBABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3O4S/c12-11(13,14)19(16,17)18-8-5-4-7-2-1-3-10(15)9(7)6-8/h4-6H,1-3H2.
What are the key properties of (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate?
(8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate has a molecular weight of 294.25 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-oxo-6,7-dihydro-5H-naphthalen-2-yl) trifluoromethanesulfonate is sourced from PubChem (CID 11000871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).