About 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid
2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 11001000) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| PubChem CID | 11001000 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2CN1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N2O4/c19-16(20)15-9-11-5-1-2-6-12(11)10-17(15)13-7-3-4-8-14(13)18(21)22/h1-8,15H,9-10H2,(H,19,20) |
| InChIKey | ARXBUKFIQNYJGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
The IUPAC name of 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CID 11001000) is 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
What is the SMILES notation for 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
The canonical SMILES for 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid is O=C(O)C1Cc2ccccc2CN1c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
The InChIKey is ARXBUKFIQNYJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c19-16(20)15-9-11-5-1-2-6-12(11)10-17(15)13-7-3-4-8-14(13)18(21)22/h1-8,15H,9-10H2,(H,19,20).
What are the key properties of 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid?
2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid has a molecular weight of 298.30 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid is sourced from PubChem (CID 11001000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).