C11H20N4O2 — CID 110010595
1-(1-hydroxypropan-2-yl)-1-methyl-3-(1-propan-2-ylpyrazol-4-yl)urea (PubChem CID 110010595) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yl)-1-methyl-3-(1-propan-2-ylpyrazol-4-yl)urea.
| Compound Name | 1-(1-hydroxypropan-2-yl)-1-methyl-3-(1-propan-2-ylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 110010595 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(1-hydroxypropan-2-yl)-1-methyl-3-(1-propan-2-ylpyrazol-4-yl)urea |
| SMILES | CC(CO)N(C)C(=O)Nc1cnn(C(C)C)c1 |
| InChI | InChI=1S/C11H20N4O2/c1-8(2)15-6-10(5-12-15)13-11(17)14(4)9(3)7-16/h5-6,8-9,16H,7H2,1-4H3,(H,13,17) |
| InChIKey | YVWDNPCSYVRPKU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |