C12H21N3OS — CID 110010696
4-[[1-(5-methyl-1H-pyrazol-4-yl)ethylamino]methyl]thian-4-ol (PubChem CID 110010696) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 4-[[1-(5-methyl-1H-pyrazol-4-yl)ethylamino]methyl]thian-4-ol.
| Compound Name | 4-[[1-(5-methyl-1H-pyrazol-4-yl)ethylamino]methyl]thian-4-ol |
|---|---|
| PubChem CID | 110010696 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-[[1-(5-methyl-1H-pyrazol-4-yl)ethylamino]methyl]thian-4-ol |
| SMILES | Cc1[nH]ncc1C(C)NCC1(O)CCSCC1 |
| InChI | InChI=1S/C12H21N3OS/c1-9(11-7-14-15-10(11)2)13-8-12(16)3-5-17-6-4-12/h7,9,13,16H,3-6,8H2,1-2H3,(H,14,15) |
| InChIKey | ANDUKQKKYRMGNM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |