C20H28FN3O — CID 110011054
2-[1-[[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]methyl]cyclohexyl]ethanol (PubChem CID 110011054) has the molecular formula C20H28FN3O and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-[1-[[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]methyl]cyclohexyl]ethanol.
| Compound Name | 2-[1-[[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]methyl]cyclohexyl]ethanol |
|---|---|
| PubChem CID | 110011054 |
| Molecular Formula | C20H28FN3O |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-[1-[[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]methyl]cyclohexyl]ethanol |
| SMILES | Cn1cc(C(NCC2(CCO)CCCCC2)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C20H28FN3O/c1-24-14-17(13-23-24)19(16-6-5-7-18(21)12-16)22-15-20(10-11-25)8-3-2-4-9-20/h5-7,12-14,19,22,25H,2-4,8-11,15H2,1H3 |
| InChIKey | ULKSMHYNZUALFK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |