C14H14N4O4 — CID 11001123
2-(3,4-dioxo-10-propyl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid (PubChem CID 11001123) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-(3,4-dioxo-10-propyl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid.
| Compound Name | 2-(3,4-dioxo-10-propyl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 11001123 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(3,4-dioxo-10-propyl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)acetic acid |
| SMILES | CCCn1c2ccccc2n2c(=O)c(=O)n(CC(=O)O)nc12 |
| InChI | InChI=1S/C14H14N4O4/c1-2-7-16-9-5-3-4-6-10(9)18-13(22)12(21)17(8-11(19)20)15-14(16)18/h3-6H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | ZEVDLWNKNMEOCH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|