C18H29NO2S — CID 110011255
[4-[[(3-methyl-1-phenylsulfanylbutan-2-yl)amino]methyl]oxan-4-yl]methanol (PubChem CID 110011255) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is [4-[[(3-methyl-1-phenylsulfanylbutan-2-yl)amino]methyl]oxan-4-yl]methanol.
| Compound Name | [4-[[(3-methyl-1-phenylsulfanylbutan-2-yl)amino]methyl]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 110011255 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | [4-[[(3-methyl-1-phenylsulfanylbutan-2-yl)amino]methyl]oxan-4-yl]methanol |
| SMILES | CC(C)C(CSc1ccccc1)NCC1(CO)CCOCC1 |
| InChI | InChI=1S/C18H29NO2S/c1-15(2)17(12-22-16-6-4-3-5-7-16)19-13-18(14-20)8-10-21-11-9-18/h3-7,15,17,19-20H,8-14H2,1-2H3 |
| InChIKey | DTEJTGJJRFSBIS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |