C14H27N3O — CID 110012210
2,3-dimethyl-1-(4-pyrazol-1-ylbutan-2-ylamino)pentan-2-ol (PubChem CID 110012210) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 2,3-dimethyl-1-(4-pyrazol-1-ylbutan-2-ylamino)pentan-2-ol.
| Compound Name | 2,3-dimethyl-1-(4-pyrazol-1-ylbutan-2-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 110012210 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 2,3-dimethyl-1-(4-pyrazol-1-ylbutan-2-ylamino)pentan-2-ol |
| SMILES | CCC(C)C(C)(O)CNC(C)CCn1cccn1 |
| InChI | InChI=1S/C14H27N3O/c1-5-12(2)14(4,18)11-15-13(3)7-10-17-9-6-8-16-17/h6,8-9,12-13,15,18H,5,7,10-11H2,1-4H3 |
| InChIKey | OIVPJPJELOWXDI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |