C14H7Cl2NO3 — CID 11001318
View drug profile → tafamidis2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 11001318) has the molecular formula C14H7Cl2NO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 11001318 |
| Molecular Formula | C14H7Cl2NO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C14H7Cl2NO3/c15-9-3-8(4-10(16)6-9)13-17-11-2-1-7(14(18)19)5-12(11)20-13/h1-6H,(H,18,19) |
| InChIKey | TXEIIPDJKFWEEC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |