C14H19ClN2O5S — CID 1100137
N-(5-chloro-2-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)methanesulfonamide (PubChem CID 1100137) has the molecular formula C14H19ClN2O5S and a molecular weight of 362.84 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)methanesulfonamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)methanesulfonamide |
|---|---|
| PubChem CID | 1100137 |
| Molecular Formula | C14H19ClN2O5S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)methanesulfonamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N1CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C14H19ClN2O5S/c1-21-13-4-3-11(15)9-12(13)17(23(2,19)20)10-14(18)16-5-7-22-8-6-16/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | VUZXZWJOVSYDBY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |