C10H15IO3 — CID 11001381
methyl 2-(2-iodopropan-2-yl)-5-methyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 11001381) has the molecular formula C10H15IO3 and a molecular weight of 310.13 g/mol. Its IUPAC name is methyl 2-(2-iodopropan-2-yl)-5-methyl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | methyl 2-(2-iodopropan-2-yl)-5-methyl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 11001381 |
| Molecular Formula | C10H15IO3 |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | methyl 2-(2-iodopropan-2-yl)-5-methyl-2,3-dihydrofuran-4-carboxylate |
| SMILES | COC(=O)C1=C(C)OC(C(C)(C)I)C1 |
| InChI | InChI=1S/C10H15IO3/c1-6-7(9(12)13-4)5-8(14-6)10(2,3)11/h8H,5H2,1-4H3 |
| InChIKey | GHNVSQTYXBEEHO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|