C15H22N2O4 — CID 110014076
N-[3-hydroxy-1-[1-(5-methylfuran-2-yl)ethylamino]-1-oxobutan-2-yl]cyclopropanecarboxamide (PubChem CID 110014076) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[3-hydroxy-1-[1-(5-methylfuran-2-yl)ethylamino]-1-oxobutan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[3-hydroxy-1-[1-(5-methylfuran-2-yl)ethylamino]-1-oxobutan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 110014076 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[3-hydroxy-1-[1-(5-methylfuran-2-yl)ethylamino]-1-oxobutan-2-yl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)C(NC(=O)C2CC2)C(C)O)o1 |
| InChI | InChI=1S/C15H22N2O4/c1-8-4-7-12(21-8)9(2)16-15(20)13(10(3)18)17-14(19)11-5-6-11/h4,7,9-11,13,18H,5-6H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | QMALMWAGXHDRRQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |