C16H16F3NO2 — CID 11001428
dibenzylazanium;2,2,2-trifluoroacetate (PubChem CID 11001428) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is dibenzylazanium;2,2,2-trifluoroacetate.
| Compound Name | dibenzylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11001428 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | dibenzylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1ccc(C[NH2+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.C2HF3O2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;3-2(4,5)1(6)7/h1-10,15H,11-12H2;(H,6,7) |
| InChIKey | RGGPDHHEMZDRQW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |