C16H24O6 — CID 11001454
(3E,5R,8S,11E,13R,16S)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione (PubChem CID 11001454) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3E,5R,8S,11E,13R,16S)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione.
| Compound Name | (3E,5R,8S,11E,13R,16S)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
|---|---|
| PubChem CID | 11001454 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3E,5R,8S,11E,13R,16S)-5,13-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
| SMILES | C[C@H]1CC[C@@H](O)/C=C/C(=O)O[C@@H](C)CC[C@@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H24O6/c1-11-3-5-13(17)8-10-16(20)22-12(2)4-6-14(18)7-9-15(19)21-11/h7-14,17-18H,3-6H2,1-2H3/b9-7+,10-8+/t11-,12-,13+,14+/m0/s1 |
| InChIKey | RBQNDQOKFICJGL-DZYDYMCZSA-N |
| XLogP | 1.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |